C14H18N2O2 — CID 15665473
2-(2-methoxyphenyl)-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-one (PubChem CID 15665473) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-one.
| Compound Name | 2-(2-methoxyphenyl)-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-one |
|---|---|
| PubChem CID | 15665473 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-(2-methoxyphenyl)-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-one |
| SMILES | COc1ccccc1N1CCN2CC(=O)CC2C1 |
| InChI | InChI=1S/C14H18N2O2/c1-18-14-5-3-2-4-13(14)16-7-6-15-10-12(17)8-11(15)9-16/h2-5,11H,6-10H2,1H3 |
| InChIKey | UVBHUDNZCILCMZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |