C18H15BrN2O2 — CID 15665491
ethyl 2-(4-bromophenyl)-3H-1,3-benzodiazepine-4-carboxylate (PubChem CID 15665491) has the molecular formula C18H15BrN2O2 and a molecular weight of 371.23 g/mol. Its IUPAC name is ethyl 2-(4-bromophenyl)-3H-1,3-benzodiazepine-4-carboxylate.
| Compound Name | ethyl 2-(4-bromophenyl)-3H-1,3-benzodiazepine-4-carboxylate |
|---|---|
| PubChem CID | 15665491 |
| Molecular Formula | C18H15BrN2O2 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | ethyl 2-(4-bromophenyl)-3H-1,3-benzodiazepine-4-carboxylate |
| SMILES | CCOC(=O)C1=Cc2ccccc2N=C(c2ccc(Br)cc2)N1 |
| InChI | InChI=1S/C18H15BrN2O2/c1-2-23-18(22)16-11-13-5-3-4-6-15(13)20-17(21-16)12-7-9-14(19)10-8-12/h3-11H,2H2,1H3,(H,20,21) |
| InChIKey | GECKCWVGEPJKOI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |