About CID 156655562
CID 156655562 (PubChem CID 156655562) has the molecular formula C34H20IrN5OPS2-2
and a molecular weight of 801.89 g/mol.
Molecular Properties
| Compound Name | CID 156655562 |
| PubChem CID | 156655562 |
| Molecular Formula | C34H20IrN5OPS2-2 |
| Molecular Weight | 801.89 g/mol |
| Exact Mass | 802.05 |
| IUPAC Name | — |
| SMILES | O=P12c3ccccc3Sc3[c-]c(-c4ccccn4)cc(c31)Sc1ccccc12.[Ir].c1cnc(-c2nc3ccccc3[n-]2)nc1 |
| InChI | InChI=1S/C23H13NOPS2.C11H7N4.Ir/c25-26-17-8-1-3-10-19(17)27-21-13-15(16-7-5-6-12-24-16)14-22(23(21)26)28-20-11-4-2-9-18(20)26;1-2-5-9-8(4-1)14-11(15-9)10-12-6-3-7-13-10;/h1-13H;1-7H;/q2*-1; |
| InChIKey | BAEIEFZGDJZILF-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 82.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 801.89 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 156655562 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156655562?
The IUPAC name of CID 156655562 (CID 156655562) is not available.
What is the SMILES notation for CID 156655562?
The canonical SMILES for CID 156655562 is O=P12c3ccccc3Sc3[c-]c(-c4ccccn4)cc(c31)Sc1ccccc12.[Ir].c1cnc(-c2nc3ccccc3[n-]2)nc1.
What is the InChIKey of CID 156655562?
The InChIKey is BAEIEFZGDJZILF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13NOPS2.C11H7N4.Ir/c25-26-17-8-1-3-10-19(17)27-21-13-15(16-7-5-6-12-24-16)14-22(23(21)26)28-20-11-4-2-9-18(20)26;1-2-5-9-8(4-1)14-11(15-9)10-12-6-3-7-13-10;/h1-13H;1-7H;/q2*-1;.
What are the key properties of CID 156655562?
CID 156655562 has a molecular weight of 801.89 g/mol, XLogP of 6.76, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156655562 is sourced from PubChem (CID 156655562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).