C12H18N4O2 — CID 15665750
(E)-1-N-(2,2-dimethylpropyl)-2-nitro-1-N'-pyridin-4-ylethene-1,1-diamine (PubChem CID 15665750) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (E)-1-N-(2,2-dimethylpropyl)-2-nitro-1-N'-pyridin-4-ylethene-1,1-diamine.
| Compound Name | (E)-1-N-(2,2-dimethylpropyl)-2-nitro-1-N'-pyridin-4-ylethene-1,1-diamine |
|---|---|
| PubChem CID | 15665750 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (E)-1-N-(2,2-dimethylpropyl)-2-nitro-1-N'-pyridin-4-ylethene-1,1-diamine |
| SMILES | CC(C)(C)CN/C(=C\[N+](=O)[O-])Nc1ccncc1 |
| InChI | InChI=1S/C12H18N4O2/c1-12(2,3)9-14-11(8-16(17)18)15-10-4-6-13-7-5-10/h4-8,14H,9H2,1-3H3,(H,13,15)/b11-8+ |
| InChIKey | DNNSCZYOGJENHD-DHZHZOJOSA-N |
| XLogP | 2.20 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|