C30H25F5N4O4 — CID 139885415
1-N'-[4-[(1R)-1-[3,4-bis(difluoromethoxy)phenyl]-2-pyridin-4-ylethyl]phenyl]-1-N-[(4-fluorophenyl)methyl]-2-nitroethene-1,1-diamine (PubChem CID 139885415) has the molecular formula C30H25F5N4O4 and a molecular weight of 600.54 g/mol. Its IUPAC name is 1-N'-[4-[(1R)-1-[3,4-bis(difluoromethoxy)phenyl]-2-pyridin-4-ylethyl]phenyl]-1-N-[(4-fluorophenyl)methyl]-2-nitroethene-1,1-diamine.
| Compound Name | 1-N'-[4-[(1R)-1-[3,4-bis(difluoromethoxy)phenyl]-2-pyridin-4-ylethyl]phenyl]-1-N-[(4-fluorophenyl)methyl]-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 139885415 |
| Molecular Formula | C30H25F5N4O4 |
| Molecular Weight | 600.54 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | 1-N'-[4-[(1R)-1-[3,4-bis(difluoromethoxy)phenyl]-2-pyridin-4-ylethyl]phenyl]-1-N-[(4-fluorophenyl)methyl]-2-nitroethene-1,1-diamine |
| SMILES | O=[N+]([O-])C=C(NCc1ccc(F)cc1)Nc1ccc([C@@H](Cc2ccncc2)c2ccc(OC(F)F)c(OC(F)F)c2)cc1 |
| InChI | InChI=1S/C30H25F5N4O4/c31-23-6-1-20(2-7-23)17-37-28(18-39(40)41)38-24-8-3-21(4-9-24)25(15-19-11-13-36-14-12-19)22-5-10-26(42-29(32)33)27(16-22)43-30(34)35/h1-14,16,18,25,29-30,37-38H,15,17H2/t25-/m1/s1 |
| InChIKey | PNANQWPIYNLBRP-RUZDIDTESA-N |
| XLogP | 7.08 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.54 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|