C15H18FGeN — CID 156657586
[6-(4-fluorophenyl)-4-(trideuteriomethyl)-3-pyridinyl]-trimethylgermane (PubChem CID 156657586) has the molecular formula C15H18FGeN and a molecular weight of 306.94 g/mol. Its IUPAC name is [6-(4-fluorophenyl)-4-(trideuteriomethyl)-3-pyridinyl]-trimethylgermane.
| Compound Name | [6-(4-fluorophenyl)-4-(trideuteriomethyl)-3-pyridinyl]-trimethylgermane |
|---|---|
| PubChem CID | 156657586 |
| Molecular Formula | C15H18FGeN |
| Molecular Weight | 306.94 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | [6-(4-fluorophenyl)-4-(trideuteriomethyl)-3-pyridinyl]-trimethylgermane |
| SMILES | [2H]C([2H])([2H])c1cc(-c2ccc(F)cc2)ncc1[Ge](C)(C)C |
| InChI | InChI=1S/C15H18FGeN/c1-11-9-15(12-5-7-13(16)8-6-12)18-10-14(11)17(2,3)4/h5-10H,1-4H3/i1D3 |
| InChIKey | HGCCEXUZKBZJCC-FIBGUPNXSA-N |
| XLogP | 3.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.94 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |