C13H11FN2 — CID 102199782
6-(4-fluorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine (PubChem CID 102199782) has the molecular formula C13H11FN2 and a molecular weight of 214.24 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine.
| Compound Name | 6-(4-fluorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 102199782 |
| Molecular Formula | C13H11FN2 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 6-(4-fluorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine |
| SMILES | Fc1ccc(-c2cc3c(cn2)CNC3)cc1 |
| InChI | InChI=1S/C13H11FN2/c14-12-3-1-9(2-4-12)13-5-10-6-15-7-11(10)8-16-13/h1-5,8,15H,6-7H2 |
| InChIKey | LJRUHTCHNLQNOR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |