C22H21NO5S — CID 15666470
(1S,4R,5S)-2-(4-methylphenyl)sulfonyl-3-oxo-4-phenylmethoxy-2-azabicyclo[2.2.2]oct-7-ene-5-carbaldehyde (PubChem CID 15666470) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is (1S,4R,5S)-2-(4-methylphenyl)sulfonyl-3-oxo-4-phenylmethoxy-2-azabicyclo[2.2.2]oct-7-ene-5-carbaldehyde.
| Compound Name | (1S,4R,5S)-2-(4-methylphenyl)sulfonyl-3-oxo-4-phenylmethoxy-2-azabicyclo[2.2.2]oct-7-ene-5-carbaldehyde |
|---|---|
| PubChem CID | 15666470 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (1S,4R,5S)-2-(4-methylphenyl)sulfonyl-3-oxo-4-phenylmethoxy-2-azabicyclo[2.2.2]oct-7-ene-5-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)[C@@]3(OCc4ccccc4)C=C[C@@H]2C[C@@H]3C=O)cc1 |
| InChI | InChI=1S/C22H21NO5S/c1-16-7-9-20(10-8-16)29(26,27)23-19-11-12-22(21(23)25,18(13-19)14-24)28-15-17-5-3-2-4-6-17/h2-12,14,18-19H,13,15H2,1H3/t18-,19-,22-/m1/s1 |
| InChIKey | BNNMOBMRDSFBQQ-WOIUINJBSA-N |
| XLogP | 2.63 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|