C25H22FN3O3S — CID 156665929
(3R)-11-hydroxy-2-[(11R)-6,6,11-trideuterio-8-fluorobenzo[c][1]benzothiepin-11-yl]-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 156665929) has the molecular formula C25H22FN3O3S and a molecular weight of 466.55 g/mol. Its IUPAC name is (3R)-11-hydroxy-2-[(11R)-6,6,11-trideuterio-8-fluorobenzo[c][1]benzothiepin-11-yl]-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3R)-11-hydroxy-2-[(11R)-6,6,11-trideuterio-8-fluorobenzo[c][1]benzothiepin-11-yl]-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 156665929 |
| Molecular Formula | C25H22FN3O3S |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | (3R)-11-hydroxy-2-[(11R)-6,6,11-trideuterio-8-fluorobenzo[c][1]benzothiepin-11-yl]-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | [2H]C1([2H])Sc2ccccc2[C@]([2H])(N2[C@@H]3CCCCN3C(=O)c3c(O)c(=O)ccn32)c2ccc(F)cc21 |
| InChI | InChI=1S/C25H22FN3O3S/c26-16-8-9-17-15(13-16)14-33-20-6-2-1-5-18(20)22(17)29-21-7-3-4-11-27(21)25(32)23-24(31)19(30)10-12-28(23)29/h1-2,5-6,8-10,12-13,21-22,31H,3-4,7,11,14H2/t21-,22-/m1/s1/i14D2,22D |
| InChIKey | KEAPVRQCXJSAQQ-TYRFTKOISA-N |
| XLogP | 3.99 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |