C41H45IrN5OSi-2 — CID 156671822
CID 156671822 (PubChem CID 156671822) has the molecular formula C41H45IrN5OSi-2 and a molecular weight of 844.15 g/mol.
| Compound Name | CID 156671822 |
|---|---|
| PubChem CID | 156671822 |
| Molecular Formula | C41H45IrN5OSi-2 |
| Molecular Weight | 844.15 g/mol |
| Exact Mass | 844.30 |
| IUPAC Name | — |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.Cc1cc(C)c2c(n1)oc1c(-c3nc4ccccc4n3C(C)(C)C)[c-]cnc12.[Ir] |
| InChI | InChI=1S/C23H21N4O.C18H24NSi.Ir/c1-13-12-14(2)25-22-18(13)19-20(28-22)15(10-11-24-19)21-26-16-8-6-7-9-17(16)27(21)23(3,4)5;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h6-9,11-12H,1-5H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | AMJGEBAVFQDXBB-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.15 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|