C37H37IrN5OSi-2 — CID 156671011
CID 156671011 (PubChem CID 156671011) has the molecular formula C37H37IrN5OSi-2 and a molecular weight of 788.04 g/mol.
| Compound Name | CID 156671011 |
|---|---|
| PubChem CID | 156671011 |
| Molecular Formula | C37H37IrN5OSi-2 |
| Molecular Weight | 788.04 g/mol |
| Exact Mass | 788.24 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.Cc1cc(C)c2c(n1)oc1c(-c3nc4ccccc4n3C(C)(C)C)[c-]cnc12.[Ir] |
| InChI | InChI=1S/C23H21N4O.C14H16NSi.Ir/c1-13-12-14(2)25-22-18(13)19-20(28-22)15(10-11-24-19)21-26-16-8-6-7-9-17(16)27(21)23(3,4)5;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h6-9,11-12H,1-5H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | LZSUAKVTNPZJDF-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.04 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|