C32H30IrN4OSi-2 — CID 162498211
CID 162498211 (PubChem CID 162498211) has the molecular formula C32H30IrN4OSi-2 and a molecular weight of 706.92 g/mol.
| Compound Name | CID 162498211 |
|---|---|
| PubChem CID | 162498211 |
| Molecular Formula | C32H30IrN4OSi-2 |
| Molecular Weight | 706.92 g/mol |
| Exact Mass | 707.18 |
| IUPAC Name | — |
| SMILES | Cc1cc2c(oc3n[c-]c(-c4ccc([Si](C)(C)C)cn4)cc32)c(C)n1.Cc1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C20H20N3OSi.C12H10N.Ir/c1-12-8-16-17-9-14(10-22-20(17)24-19(16)13(2)23-12)18-7-6-15(11-21-18)25(3,4)5;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h6-9,11H,1-5H3;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | QUAAJPACVINBLW-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.92 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|