C21H22N2O6PSTl- — CID 156673673
CID 156673673 (PubChem CID 156673673) has the molecular formula C21H22N2O6PSTl- and a molecular weight of 665.84 g/mol.
| Compound Name | CID 156673673 |
|---|---|
| PubChem CID | 156673673 |
| Molecular Formula | C21H22N2O6PSTl- |
| Molecular Weight | 665.84 g/mol |
| Exact Mass | 666.07 |
| IUPAC Name | — |
| SMILES | C=CCOC(=O)Nc1cc(O[SH-]#P)c(OC)cc1C(=O)N1c2ccccc2C[C@H]1CO.[Tl] |
| InChI | InChI=1S/C21H22N2O6PS.Tl/c1-3-8-28-21(26)22-16-11-19(29-31-30)18(27-2)10-15(16)20(25)23-14(12-24)9-13-6-4-5-7-17(13)23;/h3-7,10-11,14,24,31H,1,8-9,12H2,2H3,(H,22,26);/q-1;/t14-;/m0./s1 |
| InChIKey | MXKKCEDVYVEVSH-UQKRIMTDSA-N |
| XLogP | 3.05 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.84 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|