C22H24N2O4 — CID 158977741
prop-2-enyl N-[2-[(2S)-2-(hydroxymethyl)-2,3-dihydroindole-1-carbonyl]-4,5-dimethylphenyl]carbamate (PubChem CID 158977741) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is prop-2-enyl N-[2-[(2S)-2-(hydroxymethyl)-2,3-dihydroindole-1-carbonyl]-4,5-dimethylphenyl]carbamate.
| Compound Name | prop-2-enyl N-[2-[(2S)-2-(hydroxymethyl)-2,3-dihydroindole-1-carbonyl]-4,5-dimethylphenyl]carbamate |
|---|---|
| PubChem CID | 158977741 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | prop-2-enyl N-[2-[(2S)-2-(hydroxymethyl)-2,3-dihydroindole-1-carbonyl]-4,5-dimethylphenyl]carbamate |
| SMILES | C=CCOC(=O)Nc1cc(C)c(C)cc1C(=O)N1c2ccccc2C[C@H]1CO |
| InChI | InChI=1S/C22H24N2O4/c1-4-9-28-22(27)23-19-11-15(3)14(2)10-18(19)21(26)24-17(13-25)12-16-7-5-6-8-20(16)24/h4-8,10-11,17,25H,1,9,12-13H2,2-3H3,(H,23,27)/t17-/m0/s1 |
| InChIKey | VHEPKFXKFURAQH-KRWDZBQOSA-N |
| XLogP | 3.60 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|