C30H43NO5Si — CID 156673911
tert-butyl (4S)-4-[(E,1R)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 156673911) has the molecular formula C30H43NO5Si and a molecular weight of 525.76 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(E,1R)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(E,1R)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 156673911 |
| Molecular Formula | C30H43NO5Si |
| Molecular Weight | 525.76 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | tert-butyl (4S)-4-[(E,1R)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]([C@H](O)/C=C/CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)COC1(C)C |
| InChI | InChI=1S/C30H43NO5Si/c1-28(2,3)36-27(33)31-25(22-34-30(31,7)8)26(32)20-15-21-35-37(29(4,5)6,23-16-11-9-12-17-23)24-18-13-10-14-19-24/h9-20,25-26,32H,21-22H2,1-8H3/b20-15+/t25-,26+/m0/s1 |
| InChIKey | OAVTWVHXCZRINB-ZWTRZYDUSA-N |
| XLogP | 4.85 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.76 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|