C26H27GeN — CID 156675510
[2-(3,5-dimethylphenyl)-4-phenylquinolin-6-yl]-trimethylgermane (PubChem CID 156675510) has the molecular formula C26H27GeN and a molecular weight of 426.12 g/mol. Its IUPAC name is [2-(3,5-dimethylphenyl)-4-phenylquinolin-6-yl]-trimethylgermane.
| Compound Name | [2-(3,5-dimethylphenyl)-4-phenylquinolin-6-yl]-trimethylgermane |
|---|---|
| PubChem CID | 156675510 |
| Molecular Formula | C26H27GeN |
| Molecular Weight | 426.12 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [2-(3,5-dimethylphenyl)-4-phenylquinolin-6-yl]-trimethylgermane |
| SMILES | Cc1cc(C)cc(-c2cc(-c3ccccc3)c3cc([Ge](C)(C)C)ccc3n2)c1 |
| InChI | InChI=1S/C26H27GeN/c1-18-13-19(2)15-21(14-18)26-17-23(20-9-7-6-8-10-20)24-16-22(27(3,4)5)11-12-25(24)28-26/h6-17H,1-5H3 |
| InChIKey | AWRGAASOJMBOSO-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.12 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |