C26H27NSi — CID 156675922
[2-(3,5-dimethylphenyl)-4-phenylquinolin-5-yl]-trimethylsilane (PubChem CID 156675922) has the molecular formula C26H27NSi and a molecular weight of 381.60 g/mol. Its IUPAC name is [2-(3,5-dimethylphenyl)-4-phenylquinolin-5-yl]-trimethylsilane.
| Compound Name | [2-(3,5-dimethylphenyl)-4-phenylquinolin-5-yl]-trimethylsilane |
|---|---|
| PubChem CID | 156675922 |
| Molecular Formula | C26H27NSi |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | [2-(3,5-dimethylphenyl)-4-phenylquinolin-5-yl]-trimethylsilane |
| SMILES | Cc1cc(C)cc(-c2cc(-c3ccccc3)c3c([Si](C)(C)C)cccc3n2)c1 |
| InChI | InChI=1S/C26H27NSi/c1-18-14-19(2)16-21(15-18)24-17-22(20-10-7-6-8-11-20)26-23(27-24)12-9-13-25(26)28(3,4)5/h6-17H,1-5H3 |
| InChIKey | VFOKMGDZTBOHGU-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|