C25H19NO — CID 154625704
15-(3,5-dimethylphenyl)-4-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-8-one (PubChem CID 154625704) has the molecular formula C25H19NO and a molecular weight of 349.43 g/mol. Its IUPAC name is 15-(3,5-dimethylphenyl)-4-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-8-one.
| Compound Name | 15-(3,5-dimethylphenyl)-4-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-8-one |
|---|---|
| PubChem CID | 154625704 |
| Molecular Formula | C25H19NO |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 15-(3,5-dimethylphenyl)-4-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-8-one |
| SMILES | Cc1cc(C)cc(-c2cc3c4c(cccc4n2)C(=O)c2ccc(C)cc2-3)c1 |
| InChI | InChI=1S/C25H19NO/c1-14-7-8-18-20(12-14)21-13-23(17-10-15(2)9-16(3)11-17)26-22-6-4-5-19(24(21)22)25(18)27/h4-13H,1-3H3 |
| InChIKey | KPCXKBPMGPRFHX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |