C36H26IrN2O-2 — CID 154625647
15-(3,5-dimethylbenzene-6-id-1-yl)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one;iridium;5-methyl-2-phenylpyridine (PubChem CID 154625647) has the molecular formula C36H26IrN2O-2 and a molecular weight of 694.83 g/mol. Its IUPAC name is 15-(3,5-dimethylbenzene-6-id-1-yl)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one;iridium;5-methyl-2-phenylpyridine.
| Compound Name | 15-(3,5-dimethylbenzene-6-id-1-yl)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one;iridium;5-methyl-2-phenylpyridine |
|---|---|
| PubChem CID | 154625647 |
| Molecular Formula | C36H26IrN2O-2 |
| Molecular Weight | 694.83 g/mol |
| Exact Mass | 695.17 |
| IUPAC Name | 15-(3,5-dimethylbenzene-6-id-1-yl)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one;iridium;5-methyl-2-phenylpyridine |
| SMILES | Cc1[c-]c(-c2cc3c4c(cccc4n2)C(=O)c2ccccc2-3)cc(C)c1.Cc1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C24H16NO.C12H10N.Ir/c1-14-10-15(2)12-16(11-14)22-13-20-17-6-3-4-7-18(17)24(26)19-8-5-9-21(25-22)23(19)20;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h3-11,13H,1-2H3;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | XBPVIPWXNPLIQM-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.83 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|