C29H33NSi — CID 156675812
[2-(3-tert-butyl-5-methylphenyl)-3-phenylquinolin-5-yl]-trimethylsilane (PubChem CID 156675812) has the molecular formula C29H33NSi and a molecular weight of 423.68 g/mol. Its IUPAC name is [2-(3-tert-butyl-5-methylphenyl)-3-phenylquinolin-5-yl]-trimethylsilane.
| Compound Name | [2-(3-tert-butyl-5-methylphenyl)-3-phenylquinolin-5-yl]-trimethylsilane |
|---|---|
| PubChem CID | 156675812 |
| Molecular Formula | C29H33NSi |
| Molecular Weight | 423.68 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | [2-(3-tert-butyl-5-methylphenyl)-3-phenylquinolin-5-yl]-trimethylsilane |
| SMILES | Cc1cc(-c2nc3cccc([Si](C)(C)C)c3cc2-c2ccccc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H33NSi/c1-20-16-22(18-23(17-20)29(2,3)4)28-24(21-12-9-8-10-13-21)19-25-26(30-28)14-11-15-27(25)31(5,6)7/h8-19H,1-7H3 |
| InChIKey | YQVYQDPLLXDOFH-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.68 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|