C21H16LiNO — CID 174772689
lithium;2,3-diphenylquinolin-5-ol;hydride (PubChem CID 174772689) has the molecular formula C21H16LiNO and a molecular weight of 305.31 g/mol. Its IUPAC name is lithium;2,3-diphenylquinolin-5-ol;hydride.
| Compound Name | lithium;2,3-diphenylquinolin-5-ol;hydride |
|---|---|
| PubChem CID | 174772689 |
| Molecular Formula | C21H16LiNO |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | lithium;2,3-diphenylquinolin-5-ol;hydride |
| SMILES | Oc1cccc2nc(-c3ccccc3)c(-c3ccccc3)cc12.[H-].[Li+] |
| InChI | InChI=1S/C21H15NO.Li.H/c23-20-13-7-12-19-18(20)14-17(15-8-3-1-4-9-15)21(22-19)16-10-5-2-6-11-16;;/h1-14,23H;;/q;+1;-1 |
| InChIKey | HAECCHJXNVZWMY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |