C21H16N2O2 — CID 141304916
6-hydroxyimino-2,3-diphenyl-7,8-dihydroquinolin-5-one (PubChem CID 141304916) has the molecular formula C21H16N2O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 6-hydroxyimino-2,3-diphenyl-7,8-dihydroquinolin-5-one.
| Compound Name | 6-hydroxyimino-2,3-diphenyl-7,8-dihydroquinolin-5-one |
|---|---|
| PubChem CID | 141304916 |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 6-hydroxyimino-2,3-diphenyl-7,8-dihydroquinolin-5-one |
| SMILES | O=C1C(=NO)CCc2nc(-c3ccccc3)c(-c3ccccc3)cc21 |
| InChI | InChI=1S/C21H16N2O2/c24-21-17-13-16(14-7-3-1-4-8-14)20(15-9-5-2-6-10-15)22-18(17)11-12-19(21)23-25/h1-10,13,25H,11-12H2 |
| InChIKey | LJEIYDIYWMTOBT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|