C30H31N3O4 — CID 173056954
tert-butyl-[1-[4-(6-hydroxyimino-5-oxo-3-phenyl-7,8-dihydroquinolin-2-yl)phenyl]cyclobutyl]carbamic acid (PubChem CID 173056954) has the molecular formula C30H31N3O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is tert-butyl-[1-[4-(6-hydroxyimino-5-oxo-3-phenyl-7,8-dihydroquinolin-2-yl)phenyl]cyclobutyl]carbamic acid.
| Compound Name | tert-butyl-[1-[4-(6-hydroxyimino-5-oxo-3-phenyl-7,8-dihydroquinolin-2-yl)phenyl]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 173056954 |
| Molecular Formula | C30H31N3O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | tert-butyl-[1-[4-(6-hydroxyimino-5-oxo-3-phenyl-7,8-dihydroquinolin-2-yl)phenyl]cyclobutyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1(c2ccc(-c3nc4c(cc3-c3ccccc3)C(=O)C(=NO)CC4)cc2)CCC1 |
| InChI | InChI=1S/C30H31N3O4/c1-29(2,3)33(28(35)36)30(16-7-17-30)21-12-10-20(11-13-21)26-22(19-8-5-4-6-9-19)18-23-24(31-26)14-15-25(32-37)27(23)34/h4-6,8-13,18,37H,7,14-17H2,1-3H3,(H,35,36) |
| InChIKey | WXGWGCLZUWTDIA-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|