C19H36O5 — CID 156679904
(E)-5,6,9-trihydroxy-9-methyloctadec-7-enoic acid (PubChem CID 156679904) has the molecular formula C19H36O5 and a molecular weight of 344.49 g/mol. Its IUPAC name is (E)-5,6,9-trihydroxy-9-methyloctadec-7-enoic acid.
| Compound Name | (E)-5,6,9-trihydroxy-9-methyloctadec-7-enoic acid |
|---|---|
| PubChem CID | 156679904 |
| Molecular Formula | C19H36O5 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | (E)-5,6,9-trihydroxy-9-methyloctadec-7-enoic acid |
| SMILES | CCCCCCCCCC(C)(O)/C=C/C(O)C(O)CCCC(=O)O |
| InChI | InChI=1S/C19H36O5/c1-3-4-5-6-7-8-9-14-19(2,24)15-13-17(21)16(20)11-10-12-18(22)23/h13,15-17,20-21,24H,3-12,14H2,1-2H3,(H,22,23)/b15-13+ |
| InChIKey | QLYHCLNNMRBVPF-FYWRMAATSA-N |
| XLogP | 3.41 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|