C20H38O5 — CID 156679628
(E)-9,12,13-trihydroxy-2,2-dimethyloctadec-10-enoic acid (PubChem CID 156679628) has the molecular formula C20H38O5 and a molecular weight of 358.52 g/mol. Its IUPAC name is (E)-9,12,13-trihydroxy-2,2-dimethyloctadec-10-enoic acid.
| Compound Name | (E)-9,12,13-trihydroxy-2,2-dimethyloctadec-10-enoic acid |
|---|---|
| PubChem CID | 156679628 |
| Molecular Formula | C20H38O5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | (E)-9,12,13-trihydroxy-2,2-dimethyloctadec-10-enoic acid |
| SMILES | CCCCCC(O)C(O)/C=C/C(O)CCCCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C20H38O5/c1-4-5-8-12-17(22)18(23)14-13-16(21)11-9-6-7-10-15-20(2,3)19(24)25/h13-14,16-18,21-23H,4-12,15H2,1-3H3,(H,24,25)/b14-13+ |
| InChIKey | DUHMVQYUVUIRCY-BUHFOSPRSA-N |
| XLogP | 3.66 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|