C19H19FN4O2 — CID 156681108
1-[6-(18F)fluoro-5-(5-hydroxy-1H-indol-2-yl)-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 156681108) has the molecular formula C19H19FN4O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is 1-[6-(18F)fluoro-5-(5-hydroxy-1H-indol-2-yl)-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | 1-[6-(18F)fluoro-5-(5-hydroxy-1H-indol-2-yl)-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 156681108 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-[6-(18F)fluoro-5-(5-hydroxy-1H-indol-2-yl)-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2ccc(-c3cc4cc(O)ccc4[nH]3)c([18F])n2)CC1 |
| InChI | InChI=1S/C19H19FN4O2/c20-18-14(16-10-12-9-13(25)1-3-15(12)22-16)2-4-17(23-18)24-7-5-11(6-8-24)19(21)26/h1-4,9-11,22,25H,5-8H2,(H2,21,26)/i20-1 |
| InChIKey | CDOYPWNJMPOPHM-LRFGSCOBSA-N |
| XLogP | 2.78 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|