C19H20FN3O2 — CID 171545767
2-[2-fluoro-6-(3-methoxypiperidin-1-yl)-3-pyridinyl]-1H-indol-5-ol (PubChem CID 171545767) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 2-[2-fluoro-6-(3-methoxypiperidin-1-yl)-3-pyridinyl]-1H-indol-5-ol.
| Compound Name | 2-[2-fluoro-6-(3-methoxypiperidin-1-yl)-3-pyridinyl]-1H-indol-5-ol |
|---|---|
| PubChem CID | 171545767 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 2-[2-fluoro-6-(3-methoxypiperidin-1-yl)-3-pyridinyl]-1H-indol-5-ol |
| SMILES | COC1CCCN(c2ccc(-c3cc4cc(O)ccc4[nH]3)c(F)n2)C1 |
| InChI | InChI=1S/C19H20FN3O2/c1-25-14-3-2-8-23(11-14)18-7-5-15(19(20)22-18)17-10-12-9-13(24)4-6-16(12)21-17/h4-7,9-10,14,21,24H,2-3,8,11H2,1H3 |
| InChIKey | PEYXDAIOOSQCDA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|