C19H21FN3OP — CID 176652142
[2-[2-fluoro-6-[(3S)-3-(tritritiomethoxy)piperidin-1-yl]-3-pyridinyl]-1H-indol-5-yl]phosphane (PubChem CID 176652142) has the molecular formula C19H21FN3OP and a molecular weight of 363.39 g/mol. Its IUPAC name is [2-[2-fluoro-6-[(3S)-3-(tritritiomethoxy)piperidin-1-yl]-3-pyridinyl]-1H-indol-5-yl]phosphane.
| Compound Name | [2-[2-fluoro-6-[(3S)-3-(tritritiomethoxy)piperidin-1-yl]-3-pyridinyl]-1H-indol-5-yl]phosphane |
|---|---|
| PubChem CID | 176652142 |
| Molecular Formula | C19H21FN3OP |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | [2-[2-fluoro-6-[(3S)-3-(tritritiomethoxy)piperidin-1-yl]-3-pyridinyl]-1H-indol-5-yl]phosphane |
| SMILES | [3H]C([3H])([3H])O[C@H]1CCCN(c2ccc(-c3cc4cc(P)ccc4[nH]3)c(F)n2)C1 |
| InChI | InChI=1S/C19H21FN3OP/c1-24-13-3-2-8-23(11-13)18-7-5-15(19(20)22-18)17-10-12-9-14(25)4-6-16(12)21-17/h4-7,9-10,13,21H,2-3,8,11,25H2,1H3/t13-/m0/s1/i1T3 |
| InChIKey | OWFXIIVYKUTECU-VSMSYGILSA-N |
| XLogP | 3.48 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|