C28H20ClN3O7S2 — CID 156681942
4-(benzenesulfonamido)-6-[(5-chloro-2-phenoxyphenyl)diazenyl]-5-hydroxynaphthalene-2-sulfonic acid (PubChem CID 156681942) has the molecular formula C28H20ClN3O7S2 and a molecular weight of 610.07 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-6-[(5-chloro-2-phenoxyphenyl)diazenyl]-5-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 4-(benzenesulfonamido)-6-[(5-chloro-2-phenoxyphenyl)diazenyl]-5-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 156681942 |
| Molecular Formula | C28H20ClN3O7S2 |
| Molecular Weight | 610.07 g/mol |
| Exact Mass | 609.04 |
| IUPAC Name | 4-(benzenesulfonamido)-6-[(5-chloro-2-phenoxyphenyl)diazenyl]-5-hydroxynaphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(NS(=O)(=O)c2ccccc2)c2c(O)c(/N=N/c3cc(Cl)ccc3Oc3ccccc3)ccc2c1 |
| InChI | InChI=1S/C28H20ClN3O7S2/c29-19-12-14-26(39-20-7-3-1-4-8-20)24(16-19)31-30-23-13-11-18-15-22(41(36,37)38)17-25(27(18)28(23)33)32-40(34,35)21-9-5-2-6-10-21/h1-17,32-33H,(H,36,37,38)/b31-30+ |
| InChIKey | MLPYYYOACDWZBP-NVQSTNCTSA-N |
| XLogP | 7.45 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.07 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|