C24H29N5O — CID 156682114
5-(13-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl)-N-propan-2-ylpentanamide (PubChem CID 156682114) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is 5-(13-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl)-N-propan-2-ylpentanamide.
| Compound Name | 5-(13-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl)-N-propan-2-ylpentanamide |
|---|---|
| PubChem CID | 156682114 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 5-(13-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl)-N-propan-2-ylpentanamide |
| SMILES | CC(C)NC(=O)CCCCn1nnc2c1-c1ccccc1CN(C)c1ccccc1-2 |
| InChI | InChI=1S/C24H29N5O/c1-17(2)25-22(30)14-8-9-15-29-24-19-11-5-4-10-18(19)16-28(3)21-13-7-6-12-20(21)23(24)26-27-29/h4-7,10-13,17H,8-9,14-16H2,1-3H3,(H,25,30) |
| InChIKey | DKTVPXFRJYZDJF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|