C28H32N4O3S — CID 156683762
6-(isocyanomethyl)-3-(4-methoxyphenyl)sulfonyl-4-(4-piperidin-1-ylpiperidin-1-yl)quinoline (PubChem CID 156683762) has the molecular formula C28H32N4O3S and a molecular weight of 504.66 g/mol. Its IUPAC name is 6-(isocyanomethyl)-3-(4-methoxyphenyl)sulfonyl-4-(4-piperidin-1-ylpiperidin-1-yl)quinoline.
| Compound Name | 6-(isocyanomethyl)-3-(4-methoxyphenyl)sulfonyl-4-(4-piperidin-1-ylpiperidin-1-yl)quinoline |
|---|---|
| PubChem CID | 156683762 |
| Molecular Formula | C28H32N4O3S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 6-(isocyanomethyl)-3-(4-methoxyphenyl)sulfonyl-4-(4-piperidin-1-ylpiperidin-1-yl)quinoline |
| SMILES | [C-]#[N+]Cc1ccc2ncc(S(=O)(=O)c3ccc(OC)cc3)c(N3CCC(N4CCCCC4)CC3)c2c1 |
| InChI | InChI=1S/C28H32N4O3S/c1-29-19-21-6-11-26-25(18-21)28(32-16-12-22(13-17-32)31-14-4-3-5-15-31)27(20-30-26)36(33,34)24-9-7-23(35-2)8-10-24/h6-11,18,20,22H,3-5,12-17,19H2,2H3 |
| InChIKey | YCMXBDHOCZNAPG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 67.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|