C20H15N5O3S — CID 156683784
6-(isocyanomethyl)-3-(4-methoxyphenyl)sulfonyl-4-(1,2,4-triazol-1-yl)quinoline (PubChem CID 156683784) has the molecular formula C20H15N5O3S and a molecular weight of 405.44 g/mol. Its IUPAC name is 6-(isocyanomethyl)-3-(4-methoxyphenyl)sulfonyl-4-(1,2,4-triazol-1-yl)quinoline.
| Compound Name | 6-(isocyanomethyl)-3-(4-methoxyphenyl)sulfonyl-4-(1,2,4-triazol-1-yl)quinoline |
|---|---|
| PubChem CID | 156683784 |
| Molecular Formula | C20H15N5O3S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 6-(isocyanomethyl)-3-(4-methoxyphenyl)sulfonyl-4-(1,2,4-triazol-1-yl)quinoline |
| SMILES | [C-]#[N+]Cc1ccc2ncc(S(=O)(=O)c3ccc(OC)cc3)c(-n3cncn3)c2c1 |
| InChI | InChI=1S/C20H15N5O3S/c1-21-10-14-3-8-18-17(9-14)20(25-13-22-12-24-25)19(11-23-18)29(26,27)16-6-4-15(28-2)5-7-16/h3-9,11-13H,10H2,2H3 |
| InChIKey | KEXALFXDQCQPQX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 91.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|