C22H19F6INO7S- — CID 156683868
3,3,3-trifluoro-2-[[4-iodo-2-(4-oxoadamantane-1-carbonyl)oxybenzoyl]amino]-2-(trifluoromethyl)propane-1-sulfonate (PubChem CID 156683868) has the molecular formula C22H19F6INO7S- and a molecular weight of 682.35 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[4-iodo-2-(4-oxoadamantane-1-carbonyl)oxybenzoyl]amino]-2-(trifluoromethyl)propane-1-sulfonate.
| Compound Name | 3,3,3-trifluoro-2-[[4-iodo-2-(4-oxoadamantane-1-carbonyl)oxybenzoyl]amino]-2-(trifluoromethyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 156683868 |
| Molecular Formula | C22H19F6INO7S- |
| Molecular Weight | 682.35 g/mol |
| Exact Mass | 681.98 |
| IUPAC Name | 3,3,3-trifluoro-2-[[4-iodo-2-(4-oxoadamantane-1-carbonyl)oxybenzoyl]amino]-2-(trifluoromethyl)propane-1-sulfonate |
| SMILES | O=C(NC(CS(=O)(=O)[O-])(C(F)(F)F)C(F)(F)F)c1ccc(I)cc1OC(=O)C12CC3CC(C1)C(=O)C(C3)C2 |
| InChI | InChI=1S/C22H20F6INO7S/c23-21(24,25)20(22(26,27)28,9-38(34,35)36)30-17(32)14-2-1-13(29)5-15(14)37-18(33)19-6-10-3-11(7-19)16(31)12(4-10)8-19/h1-2,5,10-12H,3-4,6-9H2,(H,30,32)(H,34,35,36)/p-1 |
| InChIKey | ISEAVVBNCFWCOW-UHFFFAOYSA-M |
| XLogP | 3.73 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|