C32H35N3O2 — CID 156685486
(5aR,6R,9aS)-8-isocyano-6,9a-dimethyl-3-(2-phenylmethoxyethyl)-2-(4-propan-2-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazol-7-one (PubChem CID 156685486) has the molecular formula C32H35N3O2 and a molecular weight of 493.65 g/mol. Its IUPAC name is (5aR,6R,9aS)-8-isocyano-6,9a-dimethyl-3-(2-phenylmethoxyethyl)-2-(4-propan-2-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazol-7-one.
| Compound Name | (5aR,6R,9aS)-8-isocyano-6,9a-dimethyl-3-(2-phenylmethoxyethyl)-2-(4-propan-2-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazol-7-one |
|---|---|
| PubChem CID | 156685486 |
| Molecular Formula | C32H35N3O2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | (5aR,6R,9aS)-8-isocyano-6,9a-dimethyl-3-(2-phenylmethoxyethyl)-2-(4-propan-2-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazol-7-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(-c4ccc(C(C)C)cc4)n(CCOCc4ccccc4)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C32H35N3O2/c1-21(2)24-11-13-25(14-12-24)31-34-30-28(35(31)17-18-37-20-23-9-7-6-8-10-23)16-15-26-22(3)29(36)27(33-5)19-32(26,30)4/h6-14,19,21-22,26H,15-18,20H2,1-4H3/t22-,26-,32-/m1/s1 |
| InChIKey | SNCHJYFHFKUBDE-CWCNGCKHSA-N |
| XLogP | 6.73 |
| TPSA | 48.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|