C28H25N7O2 — CID 156685496
(5aR,6R,9aS)-8-isocyano-6,9a-dimethyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)-1-[4-(6-methylpyridazin-4-yl)phenyl]-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one (PubChem CID 156685496) has the molecular formula C28H25N7O2 and a molecular weight of 491.56 g/mol. Its IUPAC name is (5aR,6R,9aS)-8-isocyano-6,9a-dimethyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)-1-[4-(6-methylpyridazin-4-yl)phenyl]-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one.
| Compound Name | (5aR,6R,9aS)-8-isocyano-6,9a-dimethyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)-1-[4-(6-methylpyridazin-4-yl)phenyl]-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one |
|---|---|
| PubChem CID | 156685496 |
| Molecular Formula | C28H25N7O2 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | (5aR,6R,9aS)-8-isocyano-6,9a-dimethyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)-1-[4-(6-methylpyridazin-4-yl)phenyl]-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3c(c(-c4noc(C)n4)nn3-c3ccc(-c4cnnc(C)c4)cc3)CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C28H25N7O2/c1-15-12-19(14-30-32-15)18-6-8-20(9-7-18)35-26-21(24(33-35)27-31-17(3)37-34-27)10-11-22-16(2)25(36)23(29-5)13-28(22,26)4/h6-9,12-14,16,22H,10-11H2,1-4H3/t16-,22-,28-/m1/s1 |
| InChIKey | ZTJSFGGXCNMFOS-ZCRVEVSISA-N |
| XLogP | 4.84 |
| TPSA | 103.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|