C69H47N3 — CID 156687394
9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-N-naphthalen-1-yl-3-N,6-N,6-N-triphenyl-9-(9-phenylcarbazol-3-yl)fluorene-3,6-diamine (PubChem CID 156687394) has the molecular formula C69H47N3 and a molecular weight of 925.20 g/mol. Its IUPAC name is 9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-N-naphthalen-1-yl-3-N,6-N,6-N-triphenyl-9-(9-phenylcarbazol-3-yl)fluorene-3,6-diamine.
| Compound Name | 9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-N-naphthalen-1-yl-3-N,6-N,6-N-triphenyl-9-(9-phenylcarbazol-3-yl)fluorene-3,6-diamine |
|---|---|
| PubChem CID | 156687394 |
| Molecular Formula | C69H47N3 |
| Molecular Weight | 925.20 g/mol |
| Exact Mass | 924.42 |
| IUPAC Name | 9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-N-naphthalen-1-yl-3-N,6-N,6-N-triphenyl-9-(9-phenylcarbazol-3-yl)fluorene-3,6-diamine |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(C3(c4ccc5c(c4)c4ccccc4n5-c4ccccc4)c4ccc(N(c5ccccc5)c5ccccc5)cc4-c4cc(N(c5ccccc5)c5cccc6ccccc56)ccc43)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C69H47N3/c1-5-24-53(25-6-1)70(54-26-7-2-8-27-54)57-39-41-64-61(46-57)62-47-58(71(55-28-9-3-10-29-55)66-35-19-23-49-21-15-16-32-59(49)66)40-42-65(62)69(64,51-37-36-48-20-13-14-22-50(48)44-51)52-38-43-68-63(45-52)60-33-17-18-34-67(60)72(68)56-30-11-4-12-31-56/h1-47H/i13D,14D,20D,22D,36D,37D,44D |
| InChIKey | LIIHIZPZBORDNI-DPJONXFKSA-N |
| XLogP | 18.39 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.20 |
| LogP ≤ 5 | 18.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |