C65H45N3 — CID 156687417
9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-N,3-N,6-N,6-N-tetraphenyl-9-(9-phenylcarbazol-1-yl)fluorene-3,6-diamine (PubChem CID 156687417) has the molecular formula C65H45N3 and a molecular weight of 875.14 g/mol. Its IUPAC name is 9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-N,3-N,6-N,6-N-tetraphenyl-9-(9-phenylcarbazol-1-yl)fluorene-3,6-diamine.
| Compound Name | 9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-N,3-N,6-N,6-N-tetraphenyl-9-(9-phenylcarbazol-1-yl)fluorene-3,6-diamine |
|---|---|
| PubChem CID | 156687417 |
| Molecular Formula | C65H45N3 |
| Molecular Weight | 875.14 g/mol |
| Exact Mass | 874.41 |
| IUPAC Name | 9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-N,3-N,6-N,6-N-tetraphenyl-9-(9-phenylcarbazol-1-yl)fluorene-3,6-diamine |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(C3(c4cccc5c6ccccc6n(-c6ccccc6)c45)c4ccc(N(c5ccccc5)c5ccccc5)cc4-c4cc(N(c5ccccc5)c5ccccc5)ccc43)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C65H45N3/c1-6-23-49(24-7-1)66(50-25-8-2-9-26-50)54-39-41-60-58(44-54)59-45-55(67(51-27-10-3-11-28-51)52-29-12-4-13-30-52)40-42-61(59)65(60,48-38-37-46-21-16-17-22-47(46)43-48)62-35-20-34-57-56-33-18-19-36-63(56)68(64(57)62)53-31-14-5-15-32-53/h1-45H/i16D,17D,21D,22D,37D,38D,43D |
| InChIKey | YBVBDPZNVBPZJE-MFOUKHTBSA-N |
| XLogP | 17.24 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.14 |
| LogP ≤ 5 | 17.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |