C63H42N2S — CID 156687280
9-dibenzothiophen-1-yl-9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-N-naphthalen-2-yl-3-N,6-N,6-N-triphenylfluorene-3,6-diamine (PubChem CID 156687280) has the molecular formula C63H42N2S and a molecular weight of 866.15 g/mol. Its IUPAC name is 9-dibenzothiophen-1-yl-9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-N-naphthalen-2-yl-3-N,6-N,6-N-triphenylfluorene-3,6-diamine.
| Compound Name | 9-dibenzothiophen-1-yl-9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-N-naphthalen-2-yl-3-N,6-N,6-N-triphenylfluorene-3,6-diamine |
|---|---|
| PubChem CID | 156687280 |
| Molecular Formula | C63H42N2S |
| Molecular Weight | 866.15 g/mol |
| Exact Mass | 865.35 |
| IUPAC Name | 9-dibenzothiophen-1-yl-9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-N-naphthalen-2-yl-3-N,6-N,6-N-triphenylfluorene-3,6-diamine |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(C3(c4cccc5sc6ccccc6c45)c4ccc(N(c5ccccc5)c5ccccc5)cc4-c4cc(N(c5ccccc5)c5ccc6ccccc6c5)ccc43)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C63H42N2S/c1-4-21-48(22-5-1)64(49-23-6-2-7-24-49)52-35-37-57-55(41-52)56-42-53(65(50-25-8-3-9-26-50)51-34-32-44-18-11-13-20-46(44)40-51)36-38-58(56)63(57,47-33-31-43-17-10-12-19-45(43)39-47)59-28-16-30-61-62(59)54-27-14-15-29-60(54)66-61/h1-42H/i10D,12D,17D,19D,31D,33D,39D |
| InChIKey | DMGFBDBGGJQKEZ-JCKGUTRDSA-N |
| XLogP | 17.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.15 |
| LogP ≤ 5 | 17.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |