C17H26BN3O4 — CID 156688526
tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrazolo[3,4-b]pyridine-1-carboxylate (PubChem CID 156688526) has the molecular formula C17H26BN3O4 and a molecular weight of 347.22 g/mol. Its IUPAC name is tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrazolo[3,4-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrazolo[3,4-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 156688526 |
| Molecular Formula | C17H26BN3O4 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrazolo[3,4-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1NC(B2OC(C)(C)C(C)(C)O2)c2cccnc21 |
| InChI | InChI=1S/C17H26BN3O4/c1-15(2,3)23-14(22)21-13-11(9-8-10-19-13)12(20-21)18-24-16(4,5)17(6,7)25-18/h8-10,12,20H,1-7H3 |
| InChIKey | PCTCLTIOWQUFLT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|