C42H54N3O10P — CID 156692816
tris[1-[5-(3-hydroxyphenyl)pentanoyl]azetidin-3-yl] phosphate (PubChem CID 156692816) has the molecular formula C42H54N3O10P and a molecular weight of 791.88 g/mol. Its IUPAC name is tris[1-[5-(3-hydroxyphenyl)pentanoyl]azetidin-3-yl] phosphate.
| Compound Name | tris[1-[5-(3-hydroxyphenyl)pentanoyl]azetidin-3-yl] phosphate |
|---|---|
| PubChem CID | 156692816 |
| Molecular Formula | C42H54N3O10P |
| Molecular Weight | 791.88 g/mol |
| Exact Mass | 791.35 |
| IUPAC Name | tris[1-[5-(3-hydroxyphenyl)pentanoyl]azetidin-3-yl] phosphate |
| SMILES | O=C(CCCCc1cccc(O)c1)N1CC(OP(=O)(OC2CN(C(=O)CCCCc3cccc(O)c3)C2)OC2CN(C(=O)CCCCc3cccc(O)c3)C2)C1 |
| InChI | InChI=1S/C42H54N3O10P/c46-34-16-7-13-31(22-34)10-1-4-19-40(49)43-25-37(26-43)53-56(52,54-38-27-44(28-38)41(50)20-5-2-11-32-14-8-17-35(47)23-32)55-39-29-45(30-39)42(51)21-6-3-12-33-15-9-18-36(48)24-33/h7-9,13-18,22-24,37-39,46-48H,1-6,10-12,19-21,25-30H2 |
| InChIKey | YQOBGOJQPCEJAI-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 166.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.88 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|