C37H42NO5P — CID 168720844
dibenzyl [(3R)-1-[4-[4-[2-(2-methylphenyl)ethyl]phenyl]butanoyl]pyrrolidin-3-yl] phosphate (PubChem CID 168720844) has the molecular formula C37H42NO5P and a molecular weight of 611.72 g/mol. Its IUPAC name is dibenzyl [(3R)-1-[4-[4-[2-(2-methylphenyl)ethyl]phenyl]butanoyl]pyrrolidin-3-yl] phosphate.
| Compound Name | dibenzyl [(3R)-1-[4-[4-[2-(2-methylphenyl)ethyl]phenyl]butanoyl]pyrrolidin-3-yl] phosphate |
|---|---|
| PubChem CID | 168720844 |
| Molecular Formula | C37H42NO5P |
| Molecular Weight | 611.72 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | dibenzyl [(3R)-1-[4-[4-[2-(2-methylphenyl)ethyl]phenyl]butanoyl]pyrrolidin-3-yl] phosphate |
| SMILES | Cc1ccccc1CCc1ccc(CCCC(=O)N2CC[C@@H](OP(=O)(OCc3ccccc3)OCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C37H42NO5P/c1-30-11-8-9-17-35(30)24-23-32-21-19-31(20-22-32)16-10-18-37(39)38-26-25-36(27-38)43-44(40,41-28-33-12-4-2-5-13-33)42-29-34-14-6-3-7-15-34/h2-9,11-15,17,19-22,36H,10,16,18,23-29H2,1H3/t36-/m1/s1 |
| InChIKey | KBEIJGPIUVWKHL-PSXMRANNSA-N |
| XLogP | 8.26 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.72 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|