C22H26ClNO2 — CID 55773001
4-(4-chlorophenyl)-1-(4-phenylmethoxypiperidin-1-yl)butan-1-one (PubChem CID 55773001) has the molecular formula C22H26ClNO2 and a molecular weight of 371.91 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-(4-phenylmethoxypiperidin-1-yl)butan-1-one.
| Compound Name | 4-(4-chlorophenyl)-1-(4-phenylmethoxypiperidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 55773001 |
| Molecular Formula | C22H26ClNO2 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 4-(4-chlorophenyl)-1-(4-phenylmethoxypiperidin-1-yl)butan-1-one |
| SMILES | O=C(CCCc1ccc(Cl)cc1)N1CCC(OCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H26ClNO2/c23-20-11-9-18(10-12-20)7-4-8-22(25)24-15-13-21(14-16-24)26-17-19-5-2-1-3-6-19/h1-3,5-6,9-12,21H,4,7-8,13-17H2 |
| InChIKey | CWHRRYZNHHDIEQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |