C16H22Cl2N2O2 — CID 75513595
4-amino-1-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]butan-1-one (PubChem CID 75513595) has the molecular formula C16H22Cl2N2O2 and a molecular weight of 345.27 g/mol. Its IUPAC name is 4-amino-1-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]butan-1-one.
| Compound Name | 4-amino-1-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 75513595 |
| Molecular Formula | C16H22Cl2N2O2 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 4-amino-1-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]butan-1-one |
| SMILES | NCCCC(=O)N1CCC(OCc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H22Cl2N2O2/c17-14-4-3-12(10-15(14)18)11-22-13-5-8-20(9-6-13)16(21)2-1-7-19/h3-4,10,13H,1-2,5-9,11,19H2 |
| InChIKey | BCJGBPHKMMMHSU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |