C23H38NO5P — CID 168720797
[1-[5-(2-nonylphenyl)pentanoyl]azetidin-3-yl] dihydrogen phosphate (PubChem CID 168720797) has the molecular formula C23H38NO5P and a molecular weight of 439.53 g/mol. Its IUPAC name is [1-[5-(2-nonylphenyl)pentanoyl]azetidin-3-yl] dihydrogen phosphate.
| Compound Name | [1-[5-(2-nonylphenyl)pentanoyl]azetidin-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 168720797 |
| Molecular Formula | C23H38NO5P |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | [1-[5-(2-nonylphenyl)pentanoyl]azetidin-3-yl] dihydrogen phosphate |
| SMILES | CCCCCCCCCc1ccccc1CCCCC(=O)N1CC(OP(=O)(O)O)C1 |
| InChI | InChI=1S/C23H38NO5P/c1-2-3-4-5-6-7-8-13-20-14-9-10-15-21(20)16-11-12-17-23(25)24-18-22(19-24)29-30(26,27)28/h9-10,14-15,22H,2-8,11-13,16-19H2,1H3,(H2,26,27,28) |
| InChIKey | FGPASSLDBAESSX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|