C13H22O7S — CID 156693316
ethyl 6-(methylsulfonyloxymethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate (PubChem CID 156693316) has the molecular formula C13H22O7S and a molecular weight of 322.38 g/mol. Its IUPAC name is ethyl 6-(methylsulfonyloxymethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate.
| Compound Name | ethyl 6-(methylsulfonyloxymethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 156693316 |
| Molecular Formula | C13H22O7S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | ethyl 6-(methylsulfonyloxymethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate |
| SMILES | CCOC(=O)C1CCC2(OCCO2)C(COS(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H22O7S/c1-3-17-12(14)10-4-5-13(18-6-7-19-13)11(8-10)9-20-21(2,15)16/h10-11H,3-9H2,1-2H3 |
| InChIKey | NMDIZQYYRHVGSI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|