C14H14N4O2 — CID 156694049
1-pyrazin-2-yl-3b,4,5,6,6a,7-hexahydropentaleno[2,1-c]pyrazole-3-carboxylic acid (PubChem CID 156694049) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 1-pyrazin-2-yl-3b,4,5,6,6a,7-hexahydropentaleno[2,1-c]pyrazole-3-carboxylic acid.
| Compound Name | 1-pyrazin-2-yl-3b,4,5,6,6a,7-hexahydropentaleno[2,1-c]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 156694049 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 1-pyrazin-2-yl-3b,4,5,6,6a,7-hexahydropentaleno[2,1-c]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1nn(-c2cnccn2)c2c1C1CCCC1C2 |
| InChI | InChI=1S/C14H14N4O2/c19-14(20)13-12-9-3-1-2-8(9)6-10(12)18(17-13)11-7-15-4-5-16-11/h4-5,7-9H,1-3,6H2,(H,19,20) |
| InChIKey | SLVGZFSNCZMTRG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |