C23H27ClFN5O6S — CID 156699791
N-[4-[(4-fluoropiperidin-4-yl)methoxy]-3-nitrophenyl]sulfonyl-5-(1,2,3,6-tetrahydropyridin-4-yl)pyridine-2-carboxamide;hydrochloride (PubChem CID 156699791) has the molecular formula C23H27ClFN5O6S and a molecular weight of 556.02 g/mol. Its IUPAC name is N-[4-[(4-fluoropiperidin-4-yl)methoxy]-3-nitrophenyl]sulfonyl-5-(1,2,3,6-tetrahydropyridin-4-yl)pyridine-2-carboxamide;hydrochloride.
| Compound Name | N-[4-[(4-fluoropiperidin-4-yl)methoxy]-3-nitrophenyl]sulfonyl-5-(1,2,3,6-tetrahydropyridin-4-yl)pyridine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 156699791 |
| Molecular Formula | C23H27ClFN5O6S |
| Molecular Weight | 556.02 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | N-[4-[(4-fluoropiperidin-4-yl)methoxy]-3-nitrophenyl]sulfonyl-5-(1,2,3,6-tetrahydropyridin-4-yl)pyridine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NS(=O)(=O)c1ccc(OCC2(F)CCNCC2)c([N+](=O)[O-])c1)c1ccc(C2=CCNCC2)cn1 |
| InChI | InChI=1S/C23H26FN5O6S.ClH/c24-23(7-11-26-12-8-23)15-35-21-4-2-18(13-20(21)29(31)32)36(33,34)28-22(30)19-3-1-17(14-27-19)16-5-9-25-10-6-16;/h1-5,13-14,25-26H,6-12,15H2,(H,28,30);1H |
| InChIKey | ZLCSUXWYVNOINT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 152.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.02 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|