C27H18N4O2 — CID 156700857
N-[5-(furan-2-yl)-1H-imidazol-2-yl]-2-naphthalen-1-ylquinoline-4-carboxamide (PubChem CID 156700857) has the molecular formula C27H18N4O2 and a molecular weight of 430.47 g/mol. Its IUPAC name is N-[5-(furan-2-yl)-1H-imidazol-2-yl]-2-naphthalen-1-ylquinoline-4-carboxamide.
| Compound Name | N-[5-(furan-2-yl)-1H-imidazol-2-yl]-2-naphthalen-1-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 156700857 |
| Molecular Formula | C27H18N4O2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-[5-(furan-2-yl)-1H-imidazol-2-yl]-2-naphthalen-1-ylquinoline-4-carboxamide |
| SMILES | O=C(Nc1ncc(-c2ccco2)[nH]1)c1cc(-c2cccc3ccccc23)nc2ccccc12 |
| InChI | InChI=1S/C27H18N4O2/c32-26(31-27-28-16-24(30-27)25-13-6-14-33-25)21-15-23(29-22-12-4-3-10-20(21)22)19-11-5-8-17-7-1-2-9-18(17)19/h1-16H,(H2,28,30,31,32) |
| InChIKey | PCCPAFXZAGJPSN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |