C23H17N5O2 — CID 175195077
2-(2-aminophenyl)-N-[5-(furan-2-yl)-1H-imidazol-2-yl]quinoline-4-carboxamide (PubChem CID 175195077) has the molecular formula C23H17N5O2 and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-(2-aminophenyl)-N-[5-(furan-2-yl)-1H-imidazol-2-yl]quinoline-4-carboxamide.
| Compound Name | 2-(2-aminophenyl)-N-[5-(furan-2-yl)-1H-imidazol-2-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 175195077 |
| Molecular Formula | C23H17N5O2 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-(2-aminophenyl)-N-[5-(furan-2-yl)-1H-imidazol-2-yl]quinoline-4-carboxamide |
| SMILES | Nc1ccccc1-c1cc(C(=O)Nc2ncc(-c3ccco3)[nH]2)c2ccccc2n1 |
| InChI | InChI=1S/C23H17N5O2/c24-17-8-3-1-7-15(17)19-12-16(14-6-2-4-9-18(14)26-19)22(29)28-23-25-13-20(27-23)21-10-5-11-30-21/h1-13H,24H2,(H2,25,27,28,29) |
| InChIKey | XEAACKMKWNHUOZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|