C17H17N7OS — CID 156701044
3-(methanethioylamino)-N-methyl-N-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]benzamide (PubChem CID 156701044) has the molecular formula C17H17N7OS and a molecular weight of 367.44 g/mol. Its IUPAC name is 3-(methanethioylamino)-N-methyl-N-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]benzamide.
| Compound Name | 3-(methanethioylamino)-N-methyl-N-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 156701044 |
| Molecular Formula | C17H17N7OS |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3-(methanethioylamino)-N-methyl-N-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]benzamide |
| SMILES | CC(c1ncnn1-c1ncccn1)N(C)C(=O)c1cccc(NC=S)c1 |
| InChI | InChI=1S/C17H17N7OS/c1-12(15-20-10-22-24(15)17-18-7-4-8-19-17)23(2)16(25)13-5-3-6-14(9-13)21-11-26/h3-12H,1-2H3,(H,21,26) |
| InChIKey | FKUDGOUFFXTIGX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|